C10H21NO4 — CID 123237093
3-amino-5-(2-hydroxyethoxy)-2-propan-2-yloxycyclopentan-1-ol (PubChem CID 123237093) has the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. Its IUPAC name is 3-amino-5-(2-hydroxyethoxy)-2-propan-2-yloxycyclopentan-1-ol.
| Compound Name | 3-amino-5-(2-hydroxyethoxy)-2-propan-2-yloxycyclopentan-1-ol |
|---|---|
| PubChem CID | 123237093 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 3-amino-5-(2-hydroxyethoxy)-2-propan-2-yloxycyclopentan-1-ol |
| SMILES | CC(C)OC1C(N)CC(OCCO)C1O |
| InChI | InChI=1S/C10H21NO4/c1-6(2)15-10-7(11)5-8(9(10)13)14-4-3-12/h6-10,12-13H,3-5,11H2,1-2H3 |
| InChIKey | LAXIVRURLJGZPN-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |