C14H10N2O5 — CID 171471950
7-amino-4-methyl-5-(4-nitrophenyl)-1,3-benzodioxol-2-one (PubChem CID 171471950) has the molecular formula C14H10N2O5 and a molecular weight of 286.24 g/mol. Its IUPAC name is 7-amino-4-methyl-5-(4-nitrophenyl)-1,3-benzodioxol-2-one.
| Compound Name | 7-amino-4-methyl-5-(4-nitrophenyl)-1,3-benzodioxol-2-one |
|---|---|
| PubChem CID | 171471950 |
| Molecular Formula | C14H10N2O5 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 7-amino-4-methyl-5-(4-nitrophenyl)-1,3-benzodioxol-2-one |
| SMILES | Cc1c(-c2ccc([N+](=O)[O-])cc2)cc(N)c2oc(=O)oc12 |
| InChI | InChI=1S/C14H10N2O5/c1-7-10(8-2-4-9(5-3-8)16(18)19)6-11(15)13-12(7)20-14(17)21-13/h2-6H,15H2,1H3 |
| InChIKey | WABLLANQZZJBIW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 112.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|