About cyclohexyl-ethyl-dimethylazanium;hydroxide;hydrate
cyclohexyl-ethyl-dimethylazanium;hydroxide;hydrate (PubChem CID 171472457) has the molecular formula C10H25NO2
and a molecular weight of 191.31 g/mol. Its IUPAC name is cyclohexyl-ethyl-dimethylazanium;hydroxide;hydrate.
Molecular Properties
| Compound Name | cyclohexyl-ethyl-dimethylazanium;hydroxide;hydrate |
| PubChem CID | 171472457 |
| Molecular Formula | C10H25NO2 |
| Molecular Weight | 191.31 g/mol |
| Exact Mass | 191.19 |
| IUPAC Name | cyclohexyl-ethyl-dimethylazanium;hydroxide;hydrate |
| SMILES | CC[N+](C)(C)C1CCCCC1.O.[OH-] |
| InChI | InChI=1S/C10H22N.2H2O/c1-4-11(2,3)10-8-6-5-7-9-10;;/h10H,4-9H2,1-3H3;2*1H2/q+1;;/p-1 |
| InChIKey | RFBAOJOOQVFZDJ-UHFFFAOYSA-M |
| XLogP | 1.41 |
| TPSA | 61.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl-ethyl-dimethylazanium;hydroxide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-ethyl-dimethylazanium;hydroxide;hydrate?
The IUPAC name of cyclohexyl-ethyl-dimethylazanium;hydroxide;hydrate (CID 171472457) is cyclohexyl-ethyl-dimethylazanium;hydroxide;hydrate.
What is the SMILES notation for cyclohexyl-ethyl-dimethylazanium;hydroxide;hydrate?
The canonical SMILES for cyclohexyl-ethyl-dimethylazanium;hydroxide;hydrate is CC[N+](C)(C)C1CCCCC1.O.[OH-].
What is the InChIKey of cyclohexyl-ethyl-dimethylazanium;hydroxide;hydrate?
The InChIKey is RFBAOJOOQVFZDJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H22N.2H2O/c1-4-11(2,3)10-8-6-5-7-9-10;;/h10H,4-9H2,1-3H3;2*1H2/q+1;;/p-1.
What are the key properties of cyclohexyl-ethyl-dimethylazanium;hydroxide;hydrate?
cyclohexyl-ethyl-dimethylazanium;hydroxide;hydrate has a molecular weight of 191.31 g/mol, XLogP of 1.41, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-ethyl-dimethylazanium;hydroxide;hydrate is sourced from PubChem (CID 171472457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).