C17H35NO3S — CID 87092687
dicyclohexyl(diethyl)azanium;methanesulfonate (PubChem CID 87092687) has the molecular formula C17H35NO3S and a molecular weight of 333.54 g/mol. Its IUPAC name is dicyclohexyl(diethyl)azanium;methanesulfonate.
| Compound Name | dicyclohexyl(diethyl)azanium;methanesulfonate |
|---|---|
| PubChem CID | 87092687 |
| Molecular Formula | C17H35NO3S |
| Molecular Weight | 333.54 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | dicyclohexyl(diethyl)azanium;methanesulfonate |
| SMILES | CC[N+](CC)(C1CCCCC1)C1CCCCC1.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C16H32N.CH4O3S/c1-3-17(4-2,15-11-7-5-8-12-15)16-13-9-6-10-14-16;1-5(2,3)4/h15-16H,3-14H2,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | MGQAANUVODQBAC-UHFFFAOYSA-M |
| XLogP | 3.67 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|