C24H36N6O2S — CID 171473103
(1S,2S,3S)-1-N',1-N',2-N,2-N,3-N,3-N-hexamethyl-3-[4-methyl-1-(4-methylphenyl)sulfonylindazol-5-yl]propane-1,1,2,3-tetramine (PubChem CID 171473103) has the molecular formula C24H36N6O2S and a molecular weight of 472.66 g/mol. Its IUPAC name is (1S,2S,3S)-1-N',1-N',2-N,2-N,3-N,3-N-hexamethyl-3-[4-methyl-1-(4-methylphenyl)sulfonylindazol-5-yl]propane-1,1,2,3-tetramine.
| Compound Name | (1S,2S,3S)-1-N',1-N',2-N,2-N,3-N,3-N-hexamethyl-3-[4-methyl-1-(4-methylphenyl)sulfonylindazol-5-yl]propane-1,1,2,3-tetramine |
|---|---|
| PubChem CID | 171473103 |
| Molecular Formula | C24H36N6O2S |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | (1S,2S,3S)-1-N',1-N',2-N,2-N,3-N,3-N-hexamethyl-3-[4-methyl-1-(4-methylphenyl)sulfonylindazol-5-yl]propane-1,1,2,3-tetramine |
| SMILES | Cc1ccc(S(=O)(=O)n2ncc3c(C)c([C@@H]([C@@H]([C@@H](N)N(C)C)N(C)C)N(C)C)ccc32)cc1 |
| InChI | InChI=1S/C24H36N6O2S/c1-16-9-11-18(12-10-16)33(31,32)30-21-14-13-19(17(2)20(21)15-26-30)22(27(3)4)23(28(5)6)24(25)29(7)8/h9-15,22-24H,25H2,1-8H3/t22-,23-,24-/m0/s1 |
| InChIKey | CEOVCRMAAGGODO-HJOGWXRNSA-N |
| XLogP | 2.27 |
| TPSA | 87.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|