C23H19ClN2O3S — CID 67110768
(1S,15R)-13-chloro-7-(4-methylphenyl)sulfonyl-6,7-diazapentacyclo[13.2.1.01,12.03,11.04,8]octadeca-3(11),4(8),5,9,12-pentaen-14-one (PubChem CID 67110768) has the molecular formula C23H19ClN2O3S and a molecular weight of 438.94 g/mol. Its IUPAC name is (1S,15R)-13-chloro-7-(4-methylphenyl)sulfonyl-6,7-diazapentacyclo[13.2.1.01,12.03,11.04,8]octadeca-3(11),4(8),5,9,12-pentaen-14-one.
| Compound Name | (1S,15R)-13-chloro-7-(4-methylphenyl)sulfonyl-6,7-diazapentacyclo[13.2.1.01,12.03,11.04,8]octadeca-3(11),4(8),5,9,12-pentaen-14-one |
|---|---|
| PubChem CID | 67110768 |
| Molecular Formula | C23H19ClN2O3S |
| Molecular Weight | 438.94 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | (1S,15R)-13-chloro-7-(4-methylphenyl)sulfonyl-6,7-diazapentacyclo[13.2.1.01,12.03,11.04,8]octadeca-3(11),4(8),5,9,12-pentaen-14-one |
| SMILES | Cc1ccc(S(=O)(=O)n2ncc3c4c(ccc32)C2=C(Cl)C(=O)[C@@H]3CC[C@@]2(C4)C3)cc1 |
| InChI | InChI=1S/C23H19ClN2O3S/c1-13-2-4-15(5-3-13)30(28,29)26-19-7-6-16-17(18(19)12-25-26)11-23-9-8-14(10-23)22(27)21(24)20(16)23/h2-7,12,14H,8-11H2,1H3/t14-,23+/m1/s1 |
| InChIKey | GHMQOTBPDSJROD-FATZIPQQSA-N |
| XLogP | 4.46 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.94 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|