C23H28N2O3S — CID 132544804
6-cyclohexyl-2-(4-methylphenyl)sulfonyl-4-phenyl-3,5-dihydropyridazin-4-ol (PubChem CID 132544804) has the molecular formula C23H28N2O3S and a molecular weight of 412.56 g/mol. Its IUPAC name is 6-cyclohexyl-2-(4-methylphenyl)sulfonyl-4-phenyl-3,5-dihydropyridazin-4-ol.
| Compound Name | 6-cyclohexyl-2-(4-methylphenyl)sulfonyl-4-phenyl-3,5-dihydropyridazin-4-ol |
|---|---|
| PubChem CID | 132544804 |
| Molecular Formula | C23H28N2O3S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 6-cyclohexyl-2-(4-methylphenyl)sulfonyl-4-phenyl-3,5-dihydropyridazin-4-ol |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(O)(c3ccccc3)CC(C3CCCCC3)=N2)cc1 |
| InChI | InChI=1S/C23H28N2O3S/c1-18-12-14-21(15-13-18)29(27,28)25-17-23(26,20-10-6-3-7-11-20)16-22(24-25)19-8-4-2-5-9-19/h3,6-7,10-15,19,26H,2,4-5,8-9,16-17H2,1H3 |
| InChIKey | RFXQLYHQHPDALD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |