C20H24ClN3O2 — CID 171473567
4-[(4-chlorophenyl)-cyanomethylidene]-N-methyl-N-(oxan-4-yl)piperidine-1-carboxamide (PubChem CID 171473567) has the molecular formula C20H24ClN3O2 and a molecular weight of 373.88 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)-cyanomethylidene]-N-methyl-N-(oxan-4-yl)piperidine-1-carboxamide.
| Compound Name | 4-[(4-chlorophenyl)-cyanomethylidene]-N-methyl-N-(oxan-4-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 171473567 |
| Molecular Formula | C20H24ClN3O2 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 4-[(4-chlorophenyl)-cyanomethylidene]-N-methyl-N-(oxan-4-yl)piperidine-1-carboxamide |
| SMILES | CN(C(=O)N1CCC(=C(C#N)c2ccc(Cl)cc2)CC1)C1CCOCC1 |
| InChI | InChI=1S/C20H24ClN3O2/c1-23(18-8-12-26-13-9-18)20(25)24-10-6-16(7-11-24)19(14-22)15-2-4-17(21)5-3-15/h2-5,18H,6-13H2,1H3 |
| InChIKey | HXDKAZIQOWMSDQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|