C18H17FN4O — CID 166108409
1-[4-[cyano-(4-fluorophenyl)methylidene]piperidine-1-carbonyl]azetidine-3-carbonitrile (PubChem CID 166108409) has the molecular formula C18H17FN4O and a molecular weight of 324.36 g/mol. Its IUPAC name is 1-[4-[cyano-(4-fluorophenyl)methylidene]piperidine-1-carbonyl]azetidine-3-carbonitrile.
| Compound Name | 1-[4-[cyano-(4-fluorophenyl)methylidene]piperidine-1-carbonyl]azetidine-3-carbonitrile |
|---|---|
| PubChem CID | 166108409 |
| Molecular Formula | C18H17FN4O |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 1-[4-[cyano-(4-fluorophenyl)methylidene]piperidine-1-carbonyl]azetidine-3-carbonitrile |
| SMILES | N#CC(=C1CCN(C(=O)N2CC(C#N)C2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H17FN4O/c19-16-3-1-14(2-4-16)17(10-21)15-5-7-22(8-6-15)18(24)23-11-13(9-20)12-23/h1-4,13H,5-8,11-12H2 |
| InChIKey | KAPGDDCKSOFZRM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 71.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|