C21H19FN4O — CID 166108463
2-[1-(2,3-dihydropyrrolo[2,3-b]pyridine-1-carbonyl)piperidin-4-ylidene]-2-(4-fluorophenyl)acetonitrile (PubChem CID 166108463) has the molecular formula C21H19FN4O and a molecular weight of 362.41 g/mol. Its IUPAC name is 2-[1-(2,3-dihydropyrrolo[2,3-b]pyridine-1-carbonyl)piperidin-4-ylidene]-2-(4-fluorophenyl)acetonitrile.
| Compound Name | 2-[1-(2,3-dihydropyrrolo[2,3-b]pyridine-1-carbonyl)piperidin-4-ylidene]-2-(4-fluorophenyl)acetonitrile |
|---|---|
| PubChem CID | 166108463 |
| Molecular Formula | C21H19FN4O |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 2-[1-(2,3-dihydropyrrolo[2,3-b]pyridine-1-carbonyl)piperidin-4-ylidene]-2-(4-fluorophenyl)acetonitrile |
| SMILES | N#CC(=C1CCN(C(=O)N2CCc3cccnc32)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H19FN4O/c22-18-5-3-15(4-6-18)19(14-23)16-7-11-25(12-8-16)21(27)26-13-9-17-2-1-10-24-20(17)26/h1-6,10H,7-9,11-13H2 |
| InChIKey | USFHXRSUEPLRSE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|