C20H23F3N4O3S — CID 171473603
1-[4-[cyano-[4-(trifluoromethyl)phenyl]methylidene]piperidine-1-carbonyl]piperidine-4-sulfonamide (PubChem CID 171473603) has the molecular formula C20H23F3N4O3S and a molecular weight of 456.49 g/mol. Its IUPAC name is 1-[4-[cyano-[4-(trifluoromethyl)phenyl]methylidene]piperidine-1-carbonyl]piperidine-4-sulfonamide.
| Compound Name | 1-[4-[cyano-[4-(trifluoromethyl)phenyl]methylidene]piperidine-1-carbonyl]piperidine-4-sulfonamide |
|---|---|
| PubChem CID | 171473603 |
| Molecular Formula | C20H23F3N4O3S |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 1-[4-[cyano-[4-(trifluoromethyl)phenyl]methylidene]piperidine-1-carbonyl]piperidine-4-sulfonamide |
| SMILES | N#CC(=C1CCN(C(=O)N2CCC(S(N)(=O)=O)CC2)CC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H23F3N4O3S/c21-20(22,23)16-3-1-14(2-4-16)18(13-24)15-5-9-26(10-6-15)19(28)27-11-7-17(8-12-27)31(25,29)30/h1-4,17H,5-12H2,(H2,25,29,30) |
| InChIKey | LUBKBDLECWPBJF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|