C21H16FN4O+ — CID 58024062
2,3-dihydropyrrolo[2,3-b]pyridin-1-yl-[3-(4-fluorophenyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-yl]methanone (PubChem CID 58024062) has the molecular formula C21H16FN4O+ and a molecular weight of 359.38 g/mol. Its IUPAC name is 2,3-dihydropyrrolo[2,3-b]pyridin-1-yl-[3-(4-fluorophenyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-yl]methanone.
| Compound Name | 2,3-dihydropyrrolo[2,3-b]pyridin-1-yl-[3-(4-fluorophenyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-yl]methanone |
|---|---|
| PubChem CID | 58024062 |
| Molecular Formula | C21H16FN4O+ |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 2,3-dihydropyrrolo[2,3-b]pyridin-1-yl-[3-(4-fluorophenyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-yl]methanone |
| SMILES | O=C(c1[nH]c(-c2ccc(F)cc2)[n+]2ccccc12)N1CCc2cccnc21 |
| InChI | InChI=1S/C21H15FN4O/c22-16-8-6-15(7-9-16)20-24-18(17-5-1-2-12-25(17)20)21(27)26-13-10-14-4-3-11-23-19(14)26/h1-9,11-12H,10,13H2/p+1 |
| InChIKey | ILSDQPBBBGMOBN-UHFFFAOYSA-O |
| XLogP | 3.16 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|