C33H29BrN4O7S3 — CID 171473646
5-[[2-[4-(3-bromothiophene-2-carbonyl)piperazin-1-yl]phenyl]-[2-(2-nitrophenyl)ethyl]sulfamoyl]-3-methyl-1-benzothiophene-2-carboxylic acid (PubChem CID 171473646) has the molecular formula C33H29BrN4O7S3 and a molecular weight of 769.72 g/mol. Its IUPAC name is 5-[[2-[4-(3-bromothiophene-2-carbonyl)piperazin-1-yl]phenyl]-[2-(2-nitrophenyl)ethyl]sulfamoyl]-3-methyl-1-benzothiophene-2-carboxylic acid.
| Compound Name | 5-[[2-[4-(3-bromothiophene-2-carbonyl)piperazin-1-yl]phenyl]-[2-(2-nitrophenyl)ethyl]sulfamoyl]-3-methyl-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 171473646 |
| Molecular Formula | C33H29BrN4O7S3 |
| Molecular Weight | 769.72 g/mol |
| Exact Mass | 768.04 |
| IUPAC Name | 5-[[2-[4-(3-bromothiophene-2-carbonyl)piperazin-1-yl]phenyl]-[2-(2-nitrophenyl)ethyl]sulfamoyl]-3-methyl-1-benzothiophene-2-carboxylic acid |
| SMILES | Cc1c(C(=O)O)sc2ccc(S(=O)(=O)N(CCc3ccccc3[N+](=O)[O-])c3ccccc3N3CCN(C(=O)c4sccc4Br)CC3)cc12 |
| InChI | InChI=1S/C33H29BrN4O7S3/c1-21-24-20-23(10-11-29(24)47-30(21)33(40)41)48(44,45)37(14-12-22-6-2-3-7-26(22)38(42)43)28-9-5-4-8-27(28)35-15-17-36(18-16-35)32(39)31-25(34)13-19-46-31/h2-11,13,19-20H,12,14-18H2,1H3,(H,40,41) |
| InChIKey | SUTHFQBZGCSWNP-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 141.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.72 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|