C34H32BrN3O3S3 — CID 167174754
ethyl 5-[N-benzyl-2-[4-(3-bromothiophene-2-carbonyl)piperazin-1-yl]anilino]sulfanyl-3-methyl-1-benzothiophene-2-carboxylate (PubChem CID 167174754) has the molecular formula C34H32BrN3O3S3 and a molecular weight of 706.75 g/mol. Its IUPAC name is ethyl 5-[N-benzyl-2-[4-(3-bromothiophene-2-carbonyl)piperazin-1-yl]anilino]sulfanyl-3-methyl-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 5-[N-benzyl-2-[4-(3-bromothiophene-2-carbonyl)piperazin-1-yl]anilino]sulfanyl-3-methyl-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 167174754 |
| Molecular Formula | C34H32BrN3O3S3 |
| Molecular Weight | 706.75 g/mol |
| Exact Mass | 705.08 |
| IUPAC Name | ethyl 5-[N-benzyl-2-[4-(3-bromothiophene-2-carbonyl)piperazin-1-yl]anilino]sulfanyl-3-methyl-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc2ccc(SN(Cc3ccccc3)c3ccccc3N3CCN(C(=O)c4sccc4Br)CC3)cc2c1C |
| InChI | InChI=1S/C34H32BrN3O3S3/c1-3-41-34(40)31-23(2)26-21-25(13-14-30(26)43-31)44-38(22-24-9-5-4-6-10-24)29-12-8-7-11-28(29)36-16-18-37(19-17-36)33(39)32-27(35)15-20-42-32/h4-15,20-21H,3,16-19,22H2,1-2H3 |
| InChIKey | WKFUAVWHLMIHFR-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.75 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|