C25H19BrN2 — CID 171474747
2-bromo-9-[4-phenyl-3,5-bis(trideuteriomethyl)-2-pyridinyl]carbazole (PubChem CID 171474747) has the molecular formula C25H19BrN2 and a molecular weight of 433.38 g/mol. Its IUPAC name is 2-bromo-9-[4-phenyl-3,5-bis(trideuteriomethyl)-2-pyridinyl]carbazole.
| Compound Name | 2-bromo-9-[4-phenyl-3,5-bis(trideuteriomethyl)-2-pyridinyl]carbazole |
|---|---|
| PubChem CID | 171474747 |
| Molecular Formula | C25H19BrN2 |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 2-bromo-9-[4-phenyl-3,5-bis(trideuteriomethyl)-2-pyridinyl]carbazole |
| SMILES | [2H]C([2H])([2H])c1cnc(-n2c3ccccc3c3ccc(Br)cc32)c(C([2H])([2H])[2H])c1-c1ccccc1 |
| InChI | InChI=1S/C25H19BrN2/c1-16-15-27-25(17(2)24(16)18-8-4-3-5-9-18)28-22-11-7-6-10-20(22)21-13-12-19(26)14-23(21)28/h3-15H,1-2H3/i1D3,2D3 |
| InChIKey | DLBJFICKTMASGY-WFGJKAKNSA-N |
| XLogP | 7.23 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |