C13H10N2O4 — CID 171475014
1-[4-(1,3-dioxol-2-yl)phenyl]pyrazole-4-carboxylic acid (PubChem CID 171475014) has the molecular formula C13H10N2O4 and a molecular weight of 258.23 g/mol. Its IUPAC name is 1-[4-(1,3-dioxol-2-yl)phenyl]pyrazole-4-carboxylic acid.
| Compound Name | 1-[4-(1,3-dioxol-2-yl)phenyl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 171475014 |
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 1-[4-(1,3-dioxol-2-yl)phenyl]pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cnn(-c2ccc(C3OC=CO3)cc2)c1 |
| InChI | InChI=1S/C13H10N2O4/c16-12(17)10-7-14-15(8-10)11-3-1-9(2-4-11)13-18-5-6-19-13/h1-8,13H,(H,16,17) |
| InChIKey | BNLYIQLSCJKAIJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |