C20H28N2O5 — CID 171475170
tert-butyl 3-[3-(formyloxymethyl)phenyl]-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 171475170) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is tert-butyl 3-[3-(formyloxymethyl)phenyl]-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | tert-butyl 3-[3-(formyloxymethyl)phenyl]-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 171475170 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | tert-butyl 3-[3-(formyloxymethyl)phenyl]-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CN(c1cccc(COC=O)c1)CO2 |
| InChI | InChI=1S/C20H28N2O5/c1-19(2,3)27-18(24)21-9-7-20(8-10-21)13-22(14-26-20)17-6-4-5-16(11-17)12-25-15-23/h4-6,11,15H,7-10,12-14H2,1-3H3 |
| InChIKey | MUSZFMVRBNILEY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|