C25H21F6O2P — CID 171475341
5-bis[4-(trifluoromethyl)phenyl]phosphoryl-1-phenylpentan-1-one (PubChem CID 171475341) has the molecular formula C25H21F6O2P and a molecular weight of 498.40 g/mol. Its IUPAC name is 5-bis[4-(trifluoromethyl)phenyl]phosphoryl-1-phenylpentan-1-one.
| Compound Name | 5-bis[4-(trifluoromethyl)phenyl]phosphoryl-1-phenylpentan-1-one |
|---|---|
| PubChem CID | 171475341 |
| Molecular Formula | C25H21F6O2P |
| Molecular Weight | 498.40 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 5-bis[4-(trifluoromethyl)phenyl]phosphoryl-1-phenylpentan-1-one |
| SMILES | O=C(CCCCP(=O)(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H21F6O2P/c26-24(27,28)19-9-13-21(14-10-19)34(33,22-15-11-20(12-16-22)25(29,30)31)17-5-4-8-23(32)18-6-2-1-3-7-18/h1-3,6-7,9-16H,4-5,8,17H2 |
| InChIKey | WSWLYVQUPRUBAT-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.40 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|