C38H40O2P2 — CID 102002556
[(12-diphenylphosphoryl-5,8-dimethylidenedodec-6-ynyl)-phenylphosphoryl]benzene (PubChem CID 102002556) has the molecular formula C38H40O2P2 and a molecular weight of 590.68 g/mol. Its IUPAC name is [(12-diphenylphosphoryl-5,8-dimethylidenedodec-6-ynyl)-phenylphosphoryl]benzene.
| Compound Name | [(12-diphenylphosphoryl-5,8-dimethylidenedodec-6-ynyl)-phenylphosphoryl]benzene |
|---|---|
| PubChem CID | 102002556 |
| Molecular Formula | C38H40O2P2 |
| Molecular Weight | 590.68 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | [(12-diphenylphosphoryl-5,8-dimethylidenedodec-6-ynyl)-phenylphosphoryl]benzene |
| SMILES | C=C(C#CC(=C)CCCCP(=O)(c1ccccc1)c1ccccc1)CCCCP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H40O2P2/c1-33(19-15-17-31-41(39,35-21-7-3-8-22-35)36-23-9-4-10-24-36)29-30-34(2)20-16-18-32-42(40,37-25-11-5-12-26-37)38-27-13-6-14-28-38/h3-14,21-28H,1-2,15-20,31-32H2 |
| InChIKey | QDNPBBXODJMRBO-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.68 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|