C19H25O2P — CID 141463056
[6-methoxyhexyl(phenyl)phosphoryl]benzene (PubChem CID 141463056) has the molecular formula C19H25O2P and a molecular weight of 316.38 g/mol. Its IUPAC name is [6-methoxyhexyl(phenyl)phosphoryl]benzene.
| Compound Name | [6-methoxyhexyl(phenyl)phosphoryl]benzene |
|---|---|
| PubChem CID | 141463056 |
| Molecular Formula | C19H25O2P |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | [6-methoxyhexyl(phenyl)phosphoryl]benzene |
| SMILES | COCCCCCCP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H25O2P/c1-21-16-10-2-3-11-17-22(20,18-12-6-4-7-13-18)19-14-8-5-9-15-19/h4-9,12-15H,2-3,10-11,16-17H2,1H3 |
| InChIKey | LVQYGXZFSZMVAQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|