C25H19ClN5O3+ — CID 171475817
1-[(6-chloro-3-pyridinyl)methyl]-3-[3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenyl]-2-hydroxypyrido[1,2-a]pyrimidin-1-ium-4-one (PubChem CID 171475817) has the molecular formula C25H19ClN5O3+ and a molecular weight of 472.91 g/mol. Its IUPAC name is 1-[(6-chloro-3-pyridinyl)methyl]-3-[3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenyl]-2-hydroxypyrido[1,2-a]pyrimidin-1-ium-4-one.
| Compound Name | 1-[(6-chloro-3-pyridinyl)methyl]-3-[3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenyl]-2-hydroxypyrido[1,2-a]pyrimidin-1-ium-4-one |
|---|---|
| PubChem CID | 171475817 |
| Molecular Formula | C25H19ClN5O3+ |
| Molecular Weight | 472.91 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 1-[(6-chloro-3-pyridinyl)methyl]-3-[3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenyl]-2-hydroxypyrido[1,2-a]pyrimidin-1-ium-4-one |
| SMILES | O=c1c(-c2cccc(-c3noc(C4CC4)n3)c2)c(O)[n+](Cc2ccc(Cl)nc2)c2ccccn12 |
| InChI | InChI=1S/C25H18ClN5O3/c26-19-10-7-15(13-27-19)14-31-20-6-1-2-11-30(20)24(32)21(25(31)33)17-4-3-5-18(12-17)22-28-23(34-29-22)16-8-9-16/h1-7,10-13,16H,8-9,14H2/p+1 |
| InChIKey | PHMBXRQSKQDKMX-UHFFFAOYSA-O |
| XLogP | 3.98 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.91 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|