About copper;3-pentyl-1H-pyrrol-2-ol;sulfate
copper;3-pentyl-1H-pyrrol-2-ol;sulfate (PubChem CID 171476600) has the molecular formula C9H15CuNO5S
and a molecular weight of 312.83 g/mol. Its IUPAC name is copper;3-pentyl-1H-pyrrol-2-ol;sulfate.
Molecular Properties
| Compound Name | copper;3-pentyl-1H-pyrrol-2-ol;sulfate |
| PubChem CID | 171476600 |
| Molecular Formula | C9H15CuNO5S |
| Molecular Weight | 312.83 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | copper;3-pentyl-1H-pyrrol-2-ol;sulfate |
| SMILES | CCCCCc1cc[nH]c1O.O=S(=O)([O-])[O-].[Cu+2] |
| InChI | InChI=1S/C9H15NO.Cu.H2O4S/c1-2-3-4-5-8-6-7-10-9(8)11;;1-5(2,3)4/h6-7,10-11H,2-5H2,1H3;;(H2,1,2,3,4)/q;+2;/p-2 |
| InChIKey | FCACJBBZBMWIBT-UHFFFAOYSA-L |
| XLogP | 1.11 |
| TPSA | 116.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.83 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze copper;3-pentyl-1H-pyrrol-2-ol;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;3-pentyl-1H-pyrrol-2-ol;sulfate?
The IUPAC name of copper;3-pentyl-1H-pyrrol-2-ol;sulfate (CID 171476600) is copper;3-pentyl-1H-pyrrol-2-ol;sulfate.
What is the SMILES notation for copper;3-pentyl-1H-pyrrol-2-ol;sulfate?
The canonical SMILES for copper;3-pentyl-1H-pyrrol-2-ol;sulfate is CCCCCc1cc[nH]c1O.O=S(=O)([O-])[O-].[Cu+2].
What is the InChIKey of copper;3-pentyl-1H-pyrrol-2-ol;sulfate?
The InChIKey is FCACJBBZBMWIBT-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H15NO.Cu.H2O4S/c1-2-3-4-5-8-6-7-10-9(8)11;;1-5(2,3)4/h6-7,10-11H,2-5H2,1H3;;(H2,1,2,3,4)/q;+2;/p-2.
What are the key properties of copper;3-pentyl-1H-pyrrol-2-ol;sulfate?
copper;3-pentyl-1H-pyrrol-2-ol;sulfate has a molecular weight of 312.83 g/mol, XLogP of 1.11, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for copper;3-pentyl-1H-pyrrol-2-ol;sulfate is sourced from PubChem (CID 171476600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).