About acetic acid;copper;3-pentyl-1H-pyrrol-2-ol
acetic acid;copper;3-pentyl-1H-pyrrol-2-ol (PubChem CID 171476601) has the molecular formula C11H19CuNO3
and a molecular weight of 276.82 g/mol. Its IUPAC name is acetic acid;copper;3-pentyl-1H-pyrrol-2-ol.
Molecular Properties
| Compound Name | acetic acid;copper;3-pentyl-1H-pyrrol-2-ol |
| PubChem CID | 171476601 |
| Molecular Formula | C11H19CuNO3 |
| Molecular Weight | 276.82 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | acetic acid;copper;3-pentyl-1H-pyrrol-2-ol |
| SMILES | CC(=O)O.CCCCCc1cc[nH]c1O.[Cu] |
| InChI | InChI=1S/C9H15NO.C2H4O2.Cu/c1-2-3-4-5-8-6-7-10-9(8)11;1-2(3)4;/h6-7,10-11H,2-5H2,1H3;1H3,(H,3,4); |
| InChIKey | MFFQAEGWAJYQKU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.82 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;copper;3-pentyl-1H-pyrrol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;copper;3-pentyl-1H-pyrrol-2-ol?
The IUPAC name of acetic acid;copper;3-pentyl-1H-pyrrol-2-ol (CID 171476601) is acetic acid;copper;3-pentyl-1H-pyrrol-2-ol.
What is the SMILES notation for acetic acid;copper;3-pentyl-1H-pyrrol-2-ol?
The canonical SMILES for acetic acid;copper;3-pentyl-1H-pyrrol-2-ol is CC(=O)O.CCCCCc1cc[nH]c1O.[Cu].
What is the InChIKey of acetic acid;copper;3-pentyl-1H-pyrrol-2-ol?
The InChIKey is MFFQAEGWAJYQKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO.C2H4O2.Cu/c1-2-3-4-5-8-6-7-10-9(8)11;1-2(3)4;/h6-7,10-11H,2-5H2,1H3;1H3,(H,3,4);.
What are the key properties of acetic acid;copper;3-pentyl-1H-pyrrol-2-ol?
acetic acid;copper;3-pentyl-1H-pyrrol-2-ol has a molecular weight of 276.82 g/mol, XLogP of 2.54, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;copper;3-pentyl-1H-pyrrol-2-ol is sourced from PubChem (CID 171476601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).