C38H47F3N4O7S2 — CID 171478771
ditert-butyl 9-[[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-7-yl]amino]-3,7-diazabicyclo[3.3.1]nonane-3,7-dicarboxylate (PubChem CID 171478771) has the molecular formula C38H47F3N4O7S2 and a molecular weight of 792.94 g/mol. Its IUPAC name is ditert-butyl 9-[[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-7-yl]amino]-3,7-diazabicyclo[3.3.1]nonane-3,7-dicarboxylate.
| Compound Name | ditert-butyl 9-[[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-7-yl]amino]-3,7-diazabicyclo[3.3.1]nonane-3,7-dicarboxylate |
|---|---|
| PubChem CID | 171478771 |
| Molecular Formula | C38H47F3N4O7S2 |
| Molecular Weight | 792.94 g/mol |
| Exact Mass | 792.28 |
| IUPAC Name | ditert-butyl 9-[[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-7-yl]amino]-3,7-diazabicyclo[3.3.1]nonane-3,7-dicarboxylate |
| SMILES | COc1cc(S(C)(=O)=O)ccc1NCC#Cc1sc2c(NC3C4CN(C(=O)OC(C)(C)C)CC3CN(C(=O)OC(C)(C)C)C4)cccc2c1CC(F)(F)F |
| InChI | InChI=1S/C38H47F3N4O7S2/c1-36(2,3)51-34(46)44-19-23-21-45(35(47)52-37(4,5)6)22-24(20-44)32(23)43-29-12-9-11-26-27(18-38(39,40)41)31(53-33(26)29)13-10-16-42-28-15-14-25(54(8,48)49)17-30(28)50-7/h9,11-12,14-15,17,23-24,32,42-43H,16,18-22H2,1-8H3 |
| InChIKey | OKFIEAWOMCEXPI-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.94 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|