C23H24F3N3O2PS+ — CID 174198888
[4-[3-[7-amino-3-(2,2,2-trifluoroethyl)-1-benzothiophen-2-yl]prop-2-ynylamino]-3-methoxyphenyl]-[2-(methylamino)ethyl]-oxophosphanium (PubChem CID 174198888) has the molecular formula C23H24F3N3O2PS+ and a molecular weight of 494.50 g/mol. Its IUPAC name is [4-[3-[7-amino-3-(2,2,2-trifluoroethyl)-1-benzothiophen-2-yl]prop-2-ynylamino]-3-methoxyphenyl]-[2-(methylamino)ethyl]-oxophosphanium.
| Compound Name | [4-[3-[7-amino-3-(2,2,2-trifluoroethyl)-1-benzothiophen-2-yl]prop-2-ynylamino]-3-methoxyphenyl]-[2-(methylamino)ethyl]-oxophosphanium |
|---|---|
| PubChem CID | 174198888 |
| Molecular Formula | C23H24F3N3O2PS+ |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | [4-[3-[7-amino-3-(2,2,2-trifluoroethyl)-1-benzothiophen-2-yl]prop-2-ynylamino]-3-methoxyphenyl]-[2-(methylamino)ethyl]-oxophosphanium |
| SMILES | CNCC[P+](=O)c1ccc(NCC#Cc2sc3c(N)cccc3c2CC(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C23H24F3N3O2PS/c1-28-11-12-32(30)15-8-9-19(20(13-15)31-2)29-10-4-7-21-17(14-23(24,25)26)16-5-3-6-18(27)22(16)33-21/h3,5-6,8-9,13,28-29H,10-12,14,27H2,1-2H3/q+1 |
| InChIKey | TUANBUQVLRJRNQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|