C9H15F2NO — CID 171479105
2-cyclopentyl-4,4-difluoropyrrolidin-3-ol (PubChem CID 171479105) has the molecular formula C9H15F2NO and a molecular weight of 191.22 g/mol. Its IUPAC name is 2-cyclopentyl-4,4-difluoropyrrolidin-3-ol.
| Compound Name | 2-cyclopentyl-4,4-difluoropyrrolidin-3-ol |
|---|---|
| PubChem CID | 171479105 |
| Molecular Formula | C9H15F2NO |
| Molecular Weight | 191.22 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 2-cyclopentyl-4,4-difluoropyrrolidin-3-ol |
| SMILES | OC1C(C2CCCC2)NCC1(F)F |
| InChI | InChI=1S/C9H15F2NO/c10-9(11)5-12-7(8(9)13)6-3-1-2-4-6/h6-8,12-13H,1-5H2 |
| InChIKey | IGRHAYBHWFOEAR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |