C21H18FN3O4 — CID 171481580
phenyl N-[2-fluoro-3-methyl-4-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]carbamate (PubChem CID 171481580) has the molecular formula C21H18FN3O4 and a molecular weight of 395.39 g/mol. Its IUPAC name is phenyl N-[2-fluoro-3-methyl-4-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]carbamate.
| Compound Name | phenyl N-[2-fluoro-3-methyl-4-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]carbamate |
|---|---|
| PubChem CID | 171481580 |
| Molecular Formula | C21H18FN3O4 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | phenyl N-[2-fluoro-3-methyl-4-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]carbamate |
| SMILES | CNC(=O)c1cc(Oc2ccc(NC(=O)Oc3ccccc3)c(F)c2C)ccn1 |
| InChI | InChI=1S/C21H18FN3O4/c1-13-18(28-15-10-11-24-17(12-15)20(26)23-2)9-8-16(19(13)22)25-21(27)29-14-6-4-3-5-7-14/h3-12H,1-2H3,(H,23,26)(H,25,27) |
| InChIKey | LZBSADLIHNOJHY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |