C14H20BN3O5 — CID 171482287
[5-[4-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxopiperazin-1-yl]-3-pyridinyl]boronic acid (PubChem CID 171482287) has the molecular formula C14H20BN3O5 and a molecular weight of 321.14 g/mol. Its IUPAC name is [5-[4-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxopiperazin-1-yl]-3-pyridinyl]boronic acid.
| Compound Name | [5-[4-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxopiperazin-1-yl]-3-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 171482287 |
| Molecular Formula | C14H20BN3O5 |
| Molecular Weight | 321.14 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | [5-[4-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxopiperazin-1-yl]-3-pyridinyl]boronic acid |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cncc(B(O)O)c2)C(=O)C1 |
| InChI | InChI=1S/C14H20BN3O5/c1-14(2,3)23-13(20)17-4-5-18(12(19)9-17)11-6-10(15(21)22)7-16-8-11/h6-8,21-22H,4-5,9H2,1-3H3 |
| InChIKey | HEQSFOVCIBIBKE-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.14 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|