C9H15N3O — CID 171482318
5-(cyclopentylmethyl)-2-methyl-4H-1,2,4-triazol-3-one (PubChem CID 171482318) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 5-(cyclopentylmethyl)-2-methyl-4H-1,2,4-triazol-3-one.
| Compound Name | 5-(cyclopentylmethyl)-2-methyl-4H-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 171482318 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 5-(cyclopentylmethyl)-2-methyl-4H-1,2,4-triazol-3-one |
| SMILES | Cn1nc(CC2CCCC2)[nH]c1=O |
| InChI | InChI=1S/C9H15N3O/c1-12-9(13)10-8(11-12)6-7-4-2-3-5-7/h7H,2-6H2,1H3,(H,10,11,13) |
| InChIKey | HNBMPBMROQJIFT-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |