About methyl 7-bromo-5-fluoro-2,3-dihydro-1H-indene-4-carboxylate
methyl 7-bromo-5-fluoro-2,3-dihydro-1H-indene-4-carboxylate (PubChem CID 171487907) has the molecular formula C11H10BrFO2
and a molecular weight of 273.10 g/mol. Its IUPAC name is methyl 7-bromo-5-fluoro-2,3-dihydro-1H-indene-4-carboxylate.
Analyze methyl 7-bromo-5-fluoro-2,3-dihydro-1H-indene-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-bromo-5-fluoro-2,3-dihydro-1H-indene-4-carboxylate?
The IUPAC name of methyl 7-bromo-5-fluoro-2,3-dihydro-1H-indene-4-carboxylate (CID 171487907) is methyl 7-bromo-5-fluoro-2,3-dihydro-1H-indene-4-carboxylate.
What is the SMILES notation for methyl 7-bromo-5-fluoro-2,3-dihydro-1H-indene-4-carboxylate?
The canonical SMILES for methyl 7-bromo-5-fluoro-2,3-dihydro-1H-indene-4-carboxylate is COC(=O)c1c(F)cc(Br)c2c1CCC2.
What is the InChIKey of methyl 7-bromo-5-fluoro-2,3-dihydro-1H-indene-4-carboxylate?
The InChIKey is KJLADQSOQVFWEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrFO2/c1-15-11(14)10-7-4-2-3-6(7)8(12)5-9(10)13/h5H,2-4H2,1H3.
What are the key properties of methyl 7-bromo-5-fluoro-2,3-dihydro-1H-indene-4-carboxylate?
methyl 7-bromo-5-fluoro-2,3-dihydro-1H-indene-4-carboxylate has a molecular weight of 273.10 g/mol, XLogP of 2.86, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-bromo-5-fluoro-2,3-dihydro-1H-indene-4-carboxylate is sourced from PubChem (CID 171487907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).