C25H30N4O3 — CID 171488255
(1S)-1-[1-[[5-[4-[2-[4-(2-hydroxyethylamino)cyclohexyl]ethynyl]phenyl]-1,2-oxazol-3-yl]methyl]imidazol-2-yl]ethanol (PubChem CID 171488255) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is (1S)-1-[1-[[5-[4-[2-[4-(2-hydroxyethylamino)cyclohexyl]ethynyl]phenyl]-1,2-oxazol-3-yl]methyl]imidazol-2-yl]ethanol.
| Compound Name | (1S)-1-[1-[[5-[4-[2-[4-(2-hydroxyethylamino)cyclohexyl]ethynyl]phenyl]-1,2-oxazol-3-yl]methyl]imidazol-2-yl]ethanol |
|---|---|
| PubChem CID | 171488255 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | (1S)-1-[1-[[5-[4-[2-[4-(2-hydroxyethylamino)cyclohexyl]ethynyl]phenyl]-1,2-oxazol-3-yl]methyl]imidazol-2-yl]ethanol |
| SMILES | C[C@H](O)c1nccn1Cc1cc(-c2ccc(C#CC3CCC(NCCO)CC3)cc2)on1 |
| InChI | InChI=1S/C25H30N4O3/c1-18(31)25-27-12-14-29(25)17-23-16-24(32-28-23)21-8-4-19(5-9-21)2-3-20-6-10-22(11-7-20)26-13-15-30/h4-5,8-9,12,14,16,18,20,22,26,30-31H,6-7,10-11,13,15,17H2,1H3/t18-,20?,22?/m0/s1 |
| InChIKey | CBKZUVKOIYJBFT-NLMOZGTASA-N |
| XLogP | 3.13 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|