C24H21N3O4S — CID 174239420
1-[1-[[5-[4-[2-(4-methylsulfonylphenyl)ethynyl]phenyl]-1,2-oxazol-3-yl]methyl]imidazol-2-yl]ethanol (PubChem CID 174239420) has the molecular formula C24H21N3O4S and a molecular weight of 447.52 g/mol. Its IUPAC name is 1-[1-[[5-[4-[2-(4-methylsulfonylphenyl)ethynyl]phenyl]-1,2-oxazol-3-yl]methyl]imidazol-2-yl]ethanol.
| Compound Name | 1-[1-[[5-[4-[2-(4-methylsulfonylphenyl)ethynyl]phenyl]-1,2-oxazol-3-yl]methyl]imidazol-2-yl]ethanol |
|---|---|
| PubChem CID | 174239420 |
| Molecular Formula | C24H21N3O4S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 1-[1-[[5-[4-[2-(4-methylsulfonylphenyl)ethynyl]phenyl]-1,2-oxazol-3-yl]methyl]imidazol-2-yl]ethanol |
| SMILES | CC(O)c1nccn1Cc1cc(-c2ccc(C#Cc3ccc(S(C)(=O)=O)cc3)cc2)on1 |
| InChI | InChI=1S/C24H21N3O4S/c1-17(28)24-25-13-14-27(24)16-21-15-23(31-26-21)20-9-5-18(6-10-20)3-4-19-7-11-22(12-8-19)32(2,29)30/h5-15,17,28H,16H2,1-2H3 |
| InChIKey | OEQOSUFIRRFQKJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|