C20H19N3O4 — CID 171521370
5-[4-[3-[[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]pent-4-ynoic acid (PubChem CID 171521370) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is 5-[4-[3-[[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]pent-4-ynoic acid.
| Compound Name | 5-[4-[3-[[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]pent-4-ynoic acid |
|---|---|
| PubChem CID | 171521370 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 5-[4-[3-[[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]pent-4-ynoic acid |
| SMILES | C[C@H](O)c1nccn1Cc1cc(-c2ccc(C#CCCC(=O)O)cc2)on1 |
| InChI | InChI=1S/C20H19N3O4/c1-14(24)20-21-10-11-23(20)13-17-12-18(27-22-17)16-8-6-15(7-9-16)4-2-3-5-19(25)26/h6-12,14,24H,3,5,13H2,1H3,(H,25,26)/t14-/m0/s1 |
| InChIKey | AMWAKKSHCZEFDB-AWEZNQCLSA-N |
| XLogP | 2.86 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|