C22H24N4O4 — CID 171521489
methyl 2-[4-[4-[3-[[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]but-3-ynylamino]acetate (PubChem CID 171521489) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is methyl 2-[4-[4-[3-[[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]but-3-ynylamino]acetate.
| Compound Name | methyl 2-[4-[4-[3-[[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]but-3-ynylamino]acetate |
|---|---|
| PubChem CID | 171521489 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | methyl 2-[4-[4-[3-[[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]but-3-ynylamino]acetate |
| SMILES | COC(=O)CNCCC#Cc1ccc(-c2cc(Cn3ccnc3[C@H](C)O)no2)cc1 |
| InChI | InChI=1S/C22H24N4O4/c1-16(27)22-24-11-12-26(22)15-19-13-20(30-25-19)18-8-6-17(7-9-18)5-3-4-10-23-14-21(28)29-2/h6-9,11-13,16,23,27H,4,10,14-15H2,1-2H3/t16-/m0/s1 |
| InChIKey | MRENKOGUENUKDH-INIZCTEOSA-N |
| XLogP | 2.14 |
| TPSA | 102.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|