C14H19N3O4 — CID 171490138
[(2R)-5-oxopyrrolidin-2-yl]methyl N-[(2-methoxy-6-methyl-3-pyridinyl)methyl]carbamate (PubChem CID 171490138) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is [(2R)-5-oxopyrrolidin-2-yl]methyl N-[(2-methoxy-6-methyl-3-pyridinyl)methyl]carbamate.
| Compound Name | [(2R)-5-oxopyrrolidin-2-yl]methyl N-[(2-methoxy-6-methyl-3-pyridinyl)methyl]carbamate |
|---|---|
| PubChem CID | 171490138 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | [(2R)-5-oxopyrrolidin-2-yl]methyl N-[(2-methoxy-6-methyl-3-pyridinyl)methyl]carbamate |
| SMILES | COc1nc(C)ccc1CNC(=O)OC[C@H]1CCC(=O)N1 |
| InChI | InChI=1S/C14H19N3O4/c1-9-3-4-10(13(16-9)20-2)7-15-14(19)21-8-11-5-6-12(18)17-11/h3-4,11H,5-8H2,1-2H3,(H,15,19)(H,17,18)/t11-/m1/s1 |
| InChIKey | KZLJLWKZQFEFQZ-LLVKDONJSA-N |
| XLogP | 0.90 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |