C13H16BrN3O4 — CID 171489847
[(2S)-5-oxopyrrolidin-2-yl]methyl N-[(6-bromo-2-methoxy-3-pyridinyl)methyl]carbamate (PubChem CID 171489847) has the molecular formula C13H16BrN3O4 and a molecular weight of 358.19 g/mol. Its IUPAC name is [(2S)-5-oxopyrrolidin-2-yl]methyl N-[(6-bromo-2-methoxy-3-pyridinyl)methyl]carbamate.
| Compound Name | [(2S)-5-oxopyrrolidin-2-yl]methyl N-[(6-bromo-2-methoxy-3-pyridinyl)methyl]carbamate |
|---|---|
| PubChem CID | 171489847 |
| Molecular Formula | C13H16BrN3O4 |
| Molecular Weight | 358.19 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | [(2S)-5-oxopyrrolidin-2-yl]methyl N-[(6-bromo-2-methoxy-3-pyridinyl)methyl]carbamate |
| SMILES | COc1nc(Br)ccc1CNC(=O)OC[C@@H]1CCC(=O)N1 |
| InChI | InChI=1S/C13H16BrN3O4/c1-20-12-8(2-4-10(14)17-12)6-15-13(19)21-7-9-3-5-11(18)16-9/h2,4,9H,3,5-7H2,1H3,(H,15,19)(H,16,18)/t9-/m0/s1 |
| InChIKey | AQADKEMQJGSUMW-VIFPVBQESA-N |
| XLogP | 1.36 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.19 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|