C13H14BrNO3 — CID 71982580
(5-oxopyrrolidin-2-yl)methyl 3-bromo-4-methylbenzoate (PubChem CID 71982580) has the molecular formula C13H14BrNO3 and a molecular weight of 312.16 g/mol. Its IUPAC name is (5-oxopyrrolidin-2-yl)methyl 3-bromo-4-methylbenzoate.
| Compound Name | (5-oxopyrrolidin-2-yl)methyl 3-bromo-4-methylbenzoate |
|---|---|
| PubChem CID | 71982580 |
| Molecular Formula | C13H14BrNO3 |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | (5-oxopyrrolidin-2-yl)methyl 3-bromo-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC2CCC(=O)N2)cc1Br |
| InChI | InChI=1S/C13H14BrNO3/c1-8-2-3-9(6-11(8)14)13(17)18-7-10-4-5-12(16)15-10/h2-3,6,10H,4-5,7H2,1H3,(H,15,16) |
| InChIKey | YCNWXXURZQEQMK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |