C19H17BF4N2O2 — CID 171491828
CID 171491828 (PubChem CID 171491828) has the molecular formula C19H17BF4N2O2 and a molecular weight of 392.16 g/mol.
| Compound Name | CID 171491828 |
|---|---|
| PubChem CID | 171491828 |
| Molecular Formula | C19H17BF4N2O2 |
| Molecular Weight | 392.16 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | — |
| SMILES | [B]C(C(=O)Nc1ccccc1F)C(CN(C)C=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H17BF4N2O2/c1-26(11-27)10-14(12-6-8-13(9-7-12)19(22,23)24)17(20)18(28)25-16-5-3-2-4-15(16)21/h2-9,11,14,17H,10H2,1H3,(H,25,28) |
| InChIKey | TWLPWNJGNBIRDY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.16 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|