C23H25ClN2O3 — CID 171492180
methyl 4-[7-chloro-4-[[ethyl(2-methoxyethyl)amino]methyl]quinolin-2-yl]benzoate (PubChem CID 171492180) has the molecular formula C23H25ClN2O3 and a molecular weight of 412.92 g/mol. Its IUPAC name is methyl 4-[7-chloro-4-[[ethyl(2-methoxyethyl)amino]methyl]quinolin-2-yl]benzoate.
| Compound Name | methyl 4-[7-chloro-4-[[ethyl(2-methoxyethyl)amino]methyl]quinolin-2-yl]benzoate |
|---|---|
| PubChem CID | 171492180 |
| Molecular Formula | C23H25ClN2O3 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | methyl 4-[7-chloro-4-[[ethyl(2-methoxyethyl)amino]methyl]quinolin-2-yl]benzoate |
| SMILES | CCN(CCOC)Cc1cc(-c2ccc(C(=O)OC)cc2)nc2cc(Cl)ccc12 |
| InChI | InChI=1S/C23H25ClN2O3/c1-4-26(11-12-28-2)15-18-13-21(25-22-14-19(24)9-10-20(18)22)16-5-7-17(8-6-16)23(27)29-3/h5-10,13-14H,4,11-12,15H2,1-3H3 |
| InChIKey | HBJREIOLIURWHR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |