C23H21N3O3 — CID 171492195
methyl 4-[7-cyano-4-(morpholin-4-ylmethyl)quinolin-2-yl]benzoate (PubChem CID 171492195) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is methyl 4-[7-cyano-4-(morpholin-4-ylmethyl)quinolin-2-yl]benzoate.
| Compound Name | methyl 4-[7-cyano-4-(morpholin-4-ylmethyl)quinolin-2-yl]benzoate |
|---|---|
| PubChem CID | 171492195 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | methyl 4-[7-cyano-4-(morpholin-4-ylmethyl)quinolin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cc(CN3CCOCC3)c3ccc(C#N)cc3n2)cc1 |
| InChI | InChI=1S/C23H21N3O3/c1-28-23(27)18-5-3-17(4-6-18)21-13-19(15-26-8-10-29-11-9-26)20-7-2-16(14-24)12-22(20)25-21/h2-7,12-13H,8-11,15H2,1H3 |
| InChIKey | XGEQEBGNSHREIZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 75.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |