C22H20ClN3O2 — CID 171492179
1-[4-[7-chloro-4-(morpholin-4-ylmethyl)quinolin-2-yl]phenyl]-2-iminoethanone (PubChem CID 171492179) has the molecular formula C22H20ClN3O2 and a molecular weight of 393.87 g/mol. Its IUPAC name is 1-[4-[7-chloro-4-(morpholin-4-ylmethyl)quinolin-2-yl]phenyl]-2-iminoethanone.
| Compound Name | 1-[4-[7-chloro-4-(morpholin-4-ylmethyl)quinolin-2-yl]phenyl]-2-iminoethanone |
|---|---|
| PubChem CID | 171492179 |
| Molecular Formula | C22H20ClN3O2 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 1-[4-[7-chloro-4-(morpholin-4-ylmethyl)quinolin-2-yl]phenyl]-2-iminoethanone |
| SMILES | [H]/N=C/C(=O)c1ccc(-c2cc(CN3CCOCC3)c3ccc(Cl)cc3n2)cc1 |
| InChI | InChI=1S/C22H20ClN3O2/c23-18-5-6-19-17(14-26-7-9-28-10-8-26)11-20(25-21(19)12-18)15-1-3-16(4-2-15)22(27)13-24/h1-6,11-13,24H,7-10,14H2/b24-13+ |
| InChIKey | OWTYJHYGWVGTSR-ZMOGYAJESA-N |
| XLogP | 4.22 |
| TPSA | 66.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|