C25H34F3N4O2U- — CID 171492686
7-[3-[6-[1-cyclopropylethenyl(propyl)amino]hexanoyl]azetidin-1-yl]-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one;uranium (PubChem CID 171492686) has the molecular formula C25H34F3N4O2U- and a molecular weight of 717.60 g/mol. Its IUPAC name is 7-[3-[6-[1-cyclopropylethenyl(propyl)amino]hexanoyl]azetidin-1-yl]-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one;uranium.
| Compound Name | 7-[3-[6-[1-cyclopropylethenyl(propyl)amino]hexanoyl]azetidin-1-yl]-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one;uranium |
|---|---|
| PubChem CID | 171492686 |
| Molecular Formula | C25H34F3N4O2U- |
| Molecular Weight | 717.60 g/mol |
| Exact Mass | 717.31 |
| IUPAC Name | 7-[3-[6-[1-cyclopropylethenyl(propyl)amino]hexanoyl]azetidin-1-yl]-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one;uranium |
| SMILES | [H]/[C-]=C(/C1CC1)N(CCC)CCCCCC(=O)C1CN(C2CCc3c2n[nH]c(=O)c3C(F)(F)F)C1.[U] |
| InChI | InChI=1S/C25H34F3N4O2.U/c1-3-12-31(16(2)17-8-9-17)13-6-4-5-7-21(33)18-14-32(15-18)20-11-10-19-22(25(26,27)28)24(34)30-29-23(19)20;/h2,17-18,20H,3-15H2,1H3,(H,30,34);/q-1; |
| InChIKey | QAFCJBJDBVOJBI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.60 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|