C26H39F3N4O3 — CID 171493432
7-(3-acetylazetidin-1-yl)-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one;2-cyclopropyl-2-[pentyl(propyl)amino]ethenol (PubChem CID 171493432) has the molecular formula C26H39F3N4O3 and a molecular weight of 512.62 g/mol. Its IUPAC name is 7-(3-acetylazetidin-1-yl)-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one;2-cyclopropyl-2-[pentyl(propyl)amino]ethenol.
| Compound Name | 7-(3-acetylazetidin-1-yl)-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one;2-cyclopropyl-2-[pentyl(propyl)amino]ethenol |
|---|---|
| PubChem CID | 171493432 |
| Molecular Formula | C26H39F3N4O3 |
| Molecular Weight | 512.62 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | 7-(3-acetylazetidin-1-yl)-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one;2-cyclopropyl-2-[pentyl(propyl)amino]ethenol |
| SMILES | CC(=O)C1CN(C2CCc3c2n[nH]c(=O)c3C(F)(F)F)C1.CCCCCN(CCC)C(=CO)C1CC1 |
| InChI | InChI=1S/C13H14F3N3O2.C13H25NO/c1-6(20)7-4-19(5-7)9-3-2-8-10(13(14,15)16)12(21)18-17-11(8)9;1-3-5-6-10-14(9-4-2)13(11-15)12-7-8-12/h7,9H,2-5H2,1H3,(H,18,21);11-12,15H,3-10H2,1-2H3 |
| InChIKey | GFUPHWCLVBVUMO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.62 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|