C26H45F3N4O2 — CID 171492741
7-(3-acetyl-3-methylpyrrolidin-1-yl)-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one;propane;(3R)-N,N,3-trimethylpentan-1-amine (PubChem CID 171492741) has the molecular formula C26H45F3N4O2 and a molecular weight of 502.67 g/mol. Its IUPAC name is 7-(3-acetyl-3-methylpyrrolidin-1-yl)-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one;propane;(3R)-N,N,3-trimethylpentan-1-amine.
| Compound Name | 7-(3-acetyl-3-methylpyrrolidin-1-yl)-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one;propane;(3R)-N,N,3-trimethylpentan-1-amine |
|---|---|
| PubChem CID | 171492741 |
| Molecular Formula | C26H45F3N4O2 |
| Molecular Weight | 502.67 g/mol |
| Exact Mass | 502.35 |
| IUPAC Name | 7-(3-acetyl-3-methylpyrrolidin-1-yl)-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one;propane;(3R)-N,N,3-trimethylpentan-1-amine |
| SMILES | CC(=O)C1(C)CCN(C2CCc3c2n[nH]c(=O)c3C(F)(F)F)C1.CCC.CC[C@@H](C)CCN(C)C |
| InChI | InChI=1S/C15H18F3N3O2.C8H19N.C3H8/c1-8(22)14(2)5-6-21(7-14)10-4-3-9-11(15(16,17)18)13(23)20-19-12(9)10;1-5-8(2)6-7-9(3)4;1-3-2/h10H,3-7H2,1-2H3,(H,20,23);8H,5-7H2,1-4H3;3H2,1-2H3/t;8-;/m.1./s1 |
| InChIKey | KHNCKVADRWNDFH-RORZRARGSA-N |
| XLogP | 5.48 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.67 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |