C19H25F5N4O2 — CID 171493553
4,4-difluoro-1-[3-oxo-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-7-yl]-N,N-dipropylpyrrolidine-3-carboxamide (PubChem CID 171493553) has the molecular formula C19H25F5N4O2 and a molecular weight of 436.43 g/mol. Its IUPAC name is 4,4-difluoro-1-[3-oxo-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-7-yl]-N,N-dipropylpyrrolidine-3-carboxamide.
| Compound Name | 4,4-difluoro-1-[3-oxo-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-7-yl]-N,N-dipropylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 171493553 |
| Molecular Formula | C19H25F5N4O2 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 4,4-difluoro-1-[3-oxo-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-7-yl]-N,N-dipropylpyrrolidine-3-carboxamide |
| SMILES | CCCN(CCC)C(=O)C1CN(C2CCc3c2n[nH]c(=O)c3C(F)(F)F)CC1(F)F |
| InChI | InChI=1S/C19H25F5N4O2/c1-3-7-27(8-4-2)17(30)12-9-28(10-18(12,20)21)13-6-5-11-14(19(22,23)24)16(29)26-25-15(11)13/h12-13H,3-10H2,1-2H3,(H,26,29) |
| InChIKey | YKCQJEVFTCVCHC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |