C11H15F2N — CID 171492888
(E)-2-(1,1-difluoroethyl)-N-penta-2,3-dien-2-ylbut-2-en-1-imine (PubChem CID 171492888) has the molecular formula C11H15F2N and a molecular weight of 199.24 g/mol. Its IUPAC name is (E)-2-(1,1-difluoroethyl)-N-penta-2,3-dien-2-ylbut-2-en-1-imine.
| Compound Name | (E)-2-(1,1-difluoroethyl)-N-penta-2,3-dien-2-ylbut-2-en-1-imine |
|---|---|
| PubChem CID | 171492888 |
| Molecular Formula | C11H15F2N |
| Molecular Weight | 199.24 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | (E)-2-(1,1-difluoroethyl)-N-penta-2,3-dien-2-ylbut-2-en-1-imine |
| SMILES | CC=C=C(C)/N=C/C(=C\C)C(C)(F)F |
| InChI | InChI=1S/C11H15F2N/c1-5-7-9(3)14-8-10(6-2)11(4,12)13/h5-6,8H,1-4H3/b10-6+,14-8+ |
| InChIKey | FGIKQMACFJEONW-FGEXGLGOSA-N |
| XLogP | 3.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.24 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|