C12H13F3N3O2Rb — CID 171493076
7-morpholin-6-id-4-yl-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one;rubidium(1+) (PubChem CID 171493076) has the molecular formula C12H13F3N3O2Rb and a molecular weight of 373.72 g/mol. Its IUPAC name is 7-morpholin-6-id-4-yl-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one;rubidium(1+).
| Compound Name | 7-morpholin-6-id-4-yl-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one;rubidium(1+) |
|---|---|
| PubChem CID | 171493076 |
| Molecular Formula | C12H13F3N3O2Rb |
| Molecular Weight | 373.72 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | 7-morpholin-6-id-4-yl-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one;rubidium(1+) |
| SMILES | O=c1[nH]nc2c(c1C(F)(F)F)CCC2N1C[CH-]OCC1.[Rb+] |
| InChI | InChI=1S/C12H13F3N3O2.Rb/c13-12(14,15)9-7-1-2-8(10(7)16-17-11(9)19)18-3-5-20-6-4-18;/h5,8H,1-4,6H2,(H,17,19);/q-1;+1 |
| InChIKey | CMOAUFYHEDRQOJ-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.72 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|