C11H12F3N3O2S — CID 171493180
7-(1,2,4-oxathiazinan-4-yl)-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one (PubChem CID 171493180) has the molecular formula C11H12F3N3O2S and a molecular weight of 307.30 g/mol. Its IUPAC name is 7-(1,2,4-oxathiazinan-4-yl)-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one.
| Compound Name | 7-(1,2,4-oxathiazinan-4-yl)-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one |
|---|---|
| PubChem CID | 171493180 |
| Molecular Formula | C11H12F3N3O2S |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 7-(1,2,4-oxathiazinan-4-yl)-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one |
| SMILES | O=c1[nH]nc2c(c1C(F)(F)F)CCC2N1CCOSC1 |
| InChI | InChI=1S/C11H12F3N3O2S/c12-11(13,14)8-6-1-2-7(9(6)15-16-10(8)18)17-3-4-19-20-5-17/h7H,1-5H2,(H,16,18) |
| InChIKey | IBBXGZHKXUZQJW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|