C12H23F2N — CID 171493175
ethane;(2E)-2-ethylidene-3,3-difluoro-N-propan-2-ylpentan-1-imine (PubChem CID 171493175) has the molecular formula C12H23F2N and a molecular weight of 219.32 g/mol. Its IUPAC name is ethane;(2E)-2-ethylidene-3,3-difluoro-N-propan-2-ylpentan-1-imine.
| Compound Name | ethane;(2E)-2-ethylidene-3,3-difluoro-N-propan-2-ylpentan-1-imine |
|---|---|
| PubChem CID | 171493175 |
| Molecular Formula | C12H23F2N |
| Molecular Weight | 219.32 g/mol |
| Exact Mass | 219.18 |
| IUPAC Name | ethane;(2E)-2-ethylidene-3,3-difluoro-N-propan-2-ylpentan-1-imine |
| SMILES | C/C=C(\C=N\C(C)C)C(F)(F)CC.CC |
| InChI | InChI=1S/C10H17F2N.C2H6/c1-5-9(7-13-8(3)4)10(11,12)6-2;1-2/h5,7-8H,6H2,1-4H3;1-2H3/b9-5+,13-7+; |
| InChIKey | NDQZIJICEDDITJ-AIFGFCDYSA-N |
| XLogP | 4.48 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.32 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|