C33H48F3N5O2 — CID 171493283
7-[methyl(3-oxobutyl)amino]-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one;6-[(6R)-5,6,9-trimethylundecyl]pyridine-3-carbonitrile (PubChem CID 171493283) has the molecular formula C33H48F3N5O2 and a molecular weight of 603.77 g/mol. Its IUPAC name is 7-[methyl(3-oxobutyl)amino]-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one;6-[(6R)-5,6,9-trimethylundecyl]pyridine-3-carbonitrile.
| Compound Name | 7-[methyl(3-oxobutyl)amino]-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one;6-[(6R)-5,6,9-trimethylundecyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 171493283 |
| Molecular Formula | C33H48F3N5O2 |
| Molecular Weight | 603.77 g/mol |
| Exact Mass | 603.38 |
| IUPAC Name | 7-[methyl(3-oxobutyl)amino]-4-(trifluoromethyl)-2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one;6-[(6R)-5,6,9-trimethylundecyl]pyridine-3-carbonitrile |
| SMILES | CC(=O)CCN(C)C1CCc2c1n[nH]c(=O)c2C(F)(F)F.CCC(C)CC[C@@H](C)C(C)CCCCc1ccc(C#N)cn1 |
| InChI | InChI=1S/C20H32N2.C13H16F3N3O2/c1-5-16(2)10-11-18(4)17(3)8-6-7-9-20-13-12-19(14-21)15-22-20;1-7(20)5-6-19(2)9-4-3-8-10(13(14,15)16)12(21)18-17-11(8)9/h12-13,15-18H,5-11H2,1-4H3;9H,3-6H2,1-2H3,(H,18,21)/t16?,17?,18-;/m1./s1 |
| InChIKey | OWPXXNXJHKNBMJ-QSKWFWJOSA-N |
| XLogP | 7.45 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.77 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|